C19H20N4O2S2 — CID 27522356
1-[[(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-3-(4-ethylphenyl)urea (PubChem CID 27522356) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-[[(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-3-(4-ethylphenyl)urea.
| Compound Name | 1-[[(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-3-(4-ethylphenyl)urea |
|---|---|
| PubChem CID | 27522356 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 1-[[(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-3-(4-ethylphenyl)urea |
| SMILES | CCc1ccc(NC(=O)NNC(=O)[C@@H](C)Sc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H20N4O2S2/c1-3-13-8-10-14(11-9-13)20-18(25)23-22-17(24)12(2)26-19-21-15-6-4-5-7-16(15)27-19/h4-12H,3H2,1-2H3,(H,22,24)(H2,20,23,25)/t12-/m1/s1 |
| InChIKey | GSWSKMDZZSKTGS-GFCCVEGCSA-N |
| XLogP | 4.19 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|