C21H23N5O4S — CID 46652011
N-[1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide (PubChem CID 46652011) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46652011 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide |
| SMILES | CCn1nc(C(=O)NNC(=O)C(NC(=O)c2cccs2)C(C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C21H23N5O4S/c1-4-26-21(30)14-9-6-5-8-13(14)17(25-26)20(29)24-23-19(28)16(12(2)3)22-18(27)15-10-7-11-31-15/h5-12,16H,4H2,1-3H3,(H,22,27)(H,23,28)(H,24,29) |
| InChIKey | ZMDHGIOSUXCZCL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|