C18H23N5O4 — CID 7479708
N-[(2R)-1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide (PubChem CID 7479708) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[(2R)-1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7479708 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[(2R)-1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide |
| SMILES | CCn1nc(C(=O)NNC(=O)[C@H](NC(C)=O)C(C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C18H23N5O4/c1-5-23-18(27)13-9-7-6-8-12(13)15(22-23)17(26)21-20-16(25)14(10(2)3)19-11(4)24/h6-10,14H,5H2,1-4H3,(H,19,24)(H,20,25)(H,21,26)/t14-/m1/s1 |
| InChIKey | HIWNJPPRFBNIQZ-CQSZACIVSA-N |
| XLogP | 0.34 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|