C21H22N6O4 — CID 41100775
[(2R)-1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea (PubChem CID 41100775) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is [(2R)-1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea.
| Compound Name | [(2R)-1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 41100775 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [(2R)-1-[2-(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea |
| SMILES | CCn1nc(C(=O)NNC(=O)[C@@H](Cc2ccccc2)NC(N)=O)c2ccccc2c1=O |
| InChI | InChI=1S/C21H22N6O4/c1-2-27-20(30)15-11-7-6-10-14(15)17(26-27)19(29)25-24-18(28)16(23-21(22)31)12-13-8-4-3-5-9-13/h3-11,16H,2,12H2,1H3,(H,24,28)(H,25,29)(H3,22,23,31)/t16-/m1/s1 |
| InChIKey | DEMHHWSZYDJKFJ-MRXNPFEDSA-N |
| XLogP | 0.46 |
| TPSA | 148.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|