C26H30N4O5 — CID 26889919
N'-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 26889919) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is N'-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 26889919 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N'-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | C/C=C/c1ccc(OCC(=O)NNC(=O)c2nn(CCCCC)c(=O)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C26H30N4O5/c1-4-6-9-15-30-26(33)20-12-8-7-11-19(20)24(29-30)25(32)28-27-23(31)17-35-21-14-13-18(10-5-2)16-22(21)34-3/h5,7-8,10-14,16H,4,6,9,15,17H2,1-3H3,(H,27,31)(H,28,32)/b10-5+ |
| InChIKey | PPRRWTDBBZERQV-BJMVGYQFSA-N |
| XLogP | 3.47 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|