C25H28N4O5S — CID 55913406
methyl 2-[2-[[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]carbamoyl]phenyl]sulfanylpropanoate (PubChem CID 55913406) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is methyl 2-[2-[[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]carbamoyl]phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-[[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]carbamoyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 55913406 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | methyl 2-[2-[[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]carbamoyl]phenyl]sulfanylpropanoate |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)c2ccccc2SC(C)C(=O)OC)c2ccccc2c1=O |
| InChI | InChI=1S/C25H28N4O5S/c1-4-5-10-15-29-24(32)18-12-7-6-11-17(18)21(28-29)23(31)27-26-22(30)19-13-8-9-14-20(19)35-16(2)25(33)34-3/h6-9,11-14,16H,4-5,10,15H2,1-3H3,(H,26,30)(H,27,31) |
| InChIKey | WUCNERQDXRMURN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|