C25H29N5O3S — CID 55882839
N'-(2-cyclopentylsulfanylpyridine-3-carbonyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 55882839) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is N'-(2-cyclopentylsulfanylpyridine-3-carbonyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-(2-cyclopentylsulfanylpyridine-3-carbonyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55882839 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N'-(2-cyclopentylsulfanylpyridine-3-carbonyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)c2cccnc2SC2CCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H29N5O3S/c1-2-3-8-16-30-25(33)19-13-7-6-12-18(19)21(29-30)23(32)28-27-22(31)20-14-9-15-26-24(20)34-17-10-4-5-11-17/h6-7,9,12-15,17H,2-5,8,10-11,16H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | FWTVWJGPVAXQJK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|