C19H19N5O4 — CID 27563774
N'-(2-ethoxypyridine-3-carbonyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 27563774) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is N'-(2-ethoxypyridine-3-carbonyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-(2-ethoxypyridine-3-carbonyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27563774 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N'-(2-ethoxypyridine-3-carbonyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCOc1ncccc1C(=O)NNC(=O)c1nn(CC)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H19N5O4/c1-3-24-19(27)13-9-6-5-8-12(13)15(23-24)17(26)22-21-16(25)14-10-7-11-20-18(14)28-4-2/h5-11H,3-4H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | PATPVFVOWSQPGL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|