C23H17N5O3S2 — CID 38846134
N'-[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 38846134) has the molecular formula C23H17N5O3S2 and a molecular weight of 475.56 g/mol. Its IUPAC name is N'-[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 38846134 |
| Molecular Formula | C23H17N5O3S2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | N'-[5-(1,3-benzothiazol-2-yl)thiophene-2-carbonyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2ccc(-c3nc4ccccc4s3)s2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H17N5O3S2/c1-2-28-23(31)14-8-4-3-7-13(14)19(27-28)21(30)26-25-20(29)17-11-12-18(32-17)22-24-15-9-5-6-10-16(15)33-22/h3-12H,2H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | XCFVETVMEBVQOL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|