C19H17ClN2O3S — CID 55457512
N-[3-(1,3-benzothiazol-2-yl)propyl]-5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxamide (PubChem CID 55457512) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
|---|---|
| PubChem CID | 55457512 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
| SMILES | O=C(NCCCc1nc2ccccc2s1)c1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C19H17ClN2O3S/c20-13-10-12(11-15-18(13)25-9-8-24-15)19(23)21-7-3-6-17-22-14-4-1-2-5-16(14)26-17/h1-2,4-5,10-11H,3,6-9H2,(H,21,23) |
| InChIKey | VPXARWWNUJSGML-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|