C15H15NO2S — CID 66459666
2-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylfuran-3-yl)ethanol (PubChem CID 66459666) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylfuran-3-yl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylfuran-3-yl)ethanol |
|---|---|
| PubChem CID | 66459666 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(2,5-dimethylfuran-3-yl)ethanol |
| SMILES | Cc1cc(C(O)Cc2nc3ccccc3s2)c(C)o1 |
| InChI | InChI=1S/C15H15NO2S/c1-9-7-11(10(2)18-9)13(17)8-15-16-12-5-3-4-6-14(12)19-15/h3-7,13,17H,8H2,1-2H3 |
| InChIKey | PYQOGFIXXOUURZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |