C13H11ClN2S2 — CID 83987490
2-(1,3-benzothiazol-2-yl)-2-(5-chlorothiophen-2-yl)ethanamine (PubChem CID 83987490) has the molecular formula C13H11ClN2S2 and a molecular weight of 294.83 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2-(5-chlorothiophen-2-yl)ethanamine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2-(5-chlorothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 83987490 |
| Molecular Formula | C13H11ClN2S2 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2-(5-chlorothiophen-2-yl)ethanamine |
| SMILES | NCC(c1ccc(Cl)s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H11ClN2S2/c14-12-6-5-10(17-12)8(7-15)13-16-9-3-1-2-4-11(9)18-13/h1-6,8H,7,15H2 |
| InChIKey | OIVIILFCHYFENA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |