C15H12ClFN2S — CID 43086158
N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-4-fluoroaniline (PubChem CID 43086158) has the molecular formula C15H12ClFN2S and a molecular weight of 306.79 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-4-fluoroaniline.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-4-fluoroaniline |
|---|---|
| PubChem CID | 43086158 |
| Molecular Formula | C15H12ClFN2S |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-4-fluoroaniline |
| SMILES | CC(Nc1ccc(F)cc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H12ClFN2S/c1-9(18-12-7-6-10(17)8-11(12)16)15-19-13-4-2-3-5-14(13)20-15/h2-9,18H,1H3 |
| InChIKey | ZEGRVFCFAKWDLB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |