C16H12FN3S — CID 43580253
2-[1-(1,3-benzothiazol-2-yl)ethylamino]-6-fluorobenzonitrile (PubChem CID 43580253) has the molecular formula C16H12FN3S and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[1-(1,3-benzothiazol-2-yl)ethylamino]-6-fluorobenzonitrile.
| Compound Name | 2-[1-(1,3-benzothiazol-2-yl)ethylamino]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 43580253 |
| Molecular Formula | C16H12FN3S |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[1-(1,3-benzothiazol-2-yl)ethylamino]-6-fluorobenzonitrile |
| SMILES | CC(Nc1cccc(F)c1C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H12FN3S/c1-10(16-20-14-6-2-3-8-15(14)21-16)19-13-7-4-5-12(17)11(13)9-18/h2-8,10,19H,1H3 |
| InChIKey | MMJODXQQDRTUCQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |