C16H16N2OS — CID 82731383
2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-2-pyridinyl)ethanol (PubChem CID 82731383) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-2-pyridinyl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 82731383 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-2-pyridinyl)ethanol |
| SMILES | CCc1cccnc1C(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H16N2OS/c1-2-11-6-5-9-17-16(11)13(19)10-15-18-12-7-3-4-8-14(12)20-15/h3-9,13,19H,2,10H2,1H3 |
| InChIKey | DNTVYLOXZOIUFA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |