C22H15N3O4 — CID 3804584
4-[5-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]-2-hydroxybenzoic acid (PubChem CID 3804584) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-[5-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[5-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 3804584 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[5-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]furan-2-yl]-2-hydroxybenzoic acid |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3ccc(-c4ccc(C(=O)O)c(O)c4)o3)[nH]c2c1 |
| InChI | InChI=1S/C22H15N3O4/c1-12-2-6-17-18(8-12)25-21(24-17)14(11-23)9-15-4-7-20(29-15)13-3-5-16(22(27)28)19(26)10-13/h2-10,26H,1H3,(H,24,25)(H,27,28) |
| InChIKey | LWUXXKKQRJNNTG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_F(1)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|