C19H10Br2N4O — CID 3520759
2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-[5-(2-bromophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 3520759) has the molecular formula C19H10Br2N4O and a molecular weight of 470.12 g/mol. Its IUPAC name is 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-[5-(2-bromophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-[5-(2-bromophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3520759 |
| Molecular Formula | C19H10Br2N4O |
| Molecular Weight | 470.12 g/mol |
| Exact Mass | 467.92 |
| IUPAC Name | 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-[5-(2-bromophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccccc2Br)o1)c1nc2ncc(Br)cc2[nH]1 |
| InChI | InChI=1S/C19H10Br2N4O/c20-12-8-16-19(23-10-12)25-18(24-16)11(9-22)7-13-5-6-17(26-13)14-3-1-2-4-15(14)21/h1-8,10H,(H,23,24,25) |
| InChIKey | VBDFDLBFABPOGI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.12 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|