C19H17BrN4O2 — CID 6072797
(E)-2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-(3,4-diethoxyphenyl)prop-2-enenitrile (PubChem CID 6072797) has the molecular formula C19H17BrN4O2 and a molecular weight of 413.28 g/mol. Its IUPAC name is (E)-2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-(3,4-diethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-(3,4-diethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6072797 |
| Molecular Formula | C19H17BrN4O2 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | (E)-2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-(3,4-diethoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1ccc(/C=C(\C#N)c2nc3ncc(Br)cc3[nH]2)cc1OCC |
| InChI | InChI=1S/C19H17BrN4O2/c1-3-25-16-6-5-12(8-17(16)26-4-2)7-13(10-21)18-23-15-9-14(20)11-22-19(15)24-18/h5-9,11H,3-4H2,1-2H3,(H,22,23,24)/b13-7+ |
| InChIKey | YXFAHFMQCJTZAC-NTUHNPAUSA-N |
| XLogP | 4.58 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|