C17H13BrClN5O4 — CID 171151178
2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)prop-2-enenitrile;hydrochloride (PubChem CID 171151178) has the molecular formula C17H13BrClN5O4 and a molecular weight of 466.68 g/mol. Its IUPAC name is 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)prop-2-enenitrile;hydrochloride.
| Compound Name | 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 171151178 |
| Molecular Formula | C17H13BrClN5O4 |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 464.98 |
| IUPAC Name | 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)prop-2-enenitrile;hydrochloride |
| SMILES | CCOc1cc(C=C(C#N)c2nc3ncc(Br)cc3[nH]2)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C17H12BrN5O4.ClH/c1-2-27-14-5-9(4-13(15(14)24)23(25)26)3-10(7-19)16-21-12-6-11(18)8-20-17(12)22-16;/h3-6,8,24H,2H2,1H3,(H,20,21,22);1H |
| InChIKey | WRSIZCHWVNSMHB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|