C16H15ClF3N3O2S — CID 87672584
1-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(2-methoxyethyl)thiourea (PubChem CID 87672584) has the molecular formula C16H15ClF3N3O2S and a molecular weight of 405.83 g/mol. Its IUPAC name is 1-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(2-methoxyethyl)thiourea.
| Compound Name | 1-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 87672584 |
| Molecular Formula | C16H15ClF3N3O2S |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 1-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(2-methoxyethyl)thiourea |
| SMILES | COCCN(N=Cc1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1)C(N)=S |
| InChI | InChI=1S/C16H15ClF3N3O2S/c1-24-7-6-23(15(21)26)22-9-11-3-5-14(25-11)12-8-10(16(18,19)20)2-4-13(12)17/h2-5,8-9H,6-7H2,1H3,(H2,21,26) |
| InChIKey | BBDMKFDKVZDIRF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|