C20H12ClF3O5 — CID 136659592
3-[3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one (PubChem CID 136659592) has the molecular formula C20H12ClF3O5 and a molecular weight of 424.76 g/mol. Its IUPAC name is 3-[3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one.
| Compound Name | 3-[3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 136659592 |
| Molecular Formula | C20H12ClF3O5 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 3-[3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)C=Cc2ccc(-c3cc(C(F)(F)F)ccc3Cl)o2)c(=O)o1 |
| InChI | InChI=1S/C20H12ClF3O5/c1-10-8-16(26)18(19(27)28-10)15(25)6-3-12-4-7-17(29-12)13-9-11(20(22,23)24)2-5-14(13)21/h2-9,26H,1H3 |
| InChIKey | QYZCIRWMLLNZGX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|