C17H17ClN2O2 — CID 7406865
(E)-N-(5-chloro-2-pyrrolidin-1-ylphenyl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 7406865) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is (E)-N-(5-chloro-2-pyrrolidin-1-ylphenyl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(5-chloro-2-pyrrolidin-1-ylphenyl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7406865 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (E)-N-(5-chloro-2-pyrrolidin-1-ylphenyl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1cc(Cl)ccc1N1CCCC1 |
| InChI | InChI=1S/C17H17ClN2O2/c18-13-5-7-16(20-9-1-2-10-20)15(12-13)19-17(21)8-6-14-4-3-11-22-14/h3-8,11-12H,1-2,9-10H2,(H,19,21)/b8-6+ |
| InChIKey | NUOJCXVOGAFQOM-SOFGYWHQSA-N |
| XLogP | 4.19 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|