C22H24ClIN4O2S — CID 4024109
N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-iodobenzamide (PubChem CID 4024109) has the molecular formula C22H24ClIN4O2S and a molecular weight of 570.88 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-iodobenzamide.
| Compound Name | N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 4024109 |
| Molecular Formula | C22H24ClIN4O2S |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.04 |
| IUPAC Name | N-[[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-iodobenzamide |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cccc(I)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C22H24ClIN4O2S/c1-14(2)21(30)28-10-8-27(9-11-28)19-7-6-17(13-18(19)23)25-22(31)26-20(29)15-4-3-5-16(24)12-15/h3-7,12-14H,8-11H2,1-2H3,(H2,25,26,29,31) |
| InChIKey | CTKQIKYAPGAVOR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|