C22H27ClN4O2S — CID 17110226
N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide (PubChem CID 17110226) has the molecular formula C22H27ClN4O2S and a molecular weight of 447.00 g/mol. Its IUPAC name is N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 17110226 |
| Molecular Formula | C22H27ClN4O2S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=S)NC(=O)COc3ccccc3C)cc2Cl)CC1 |
| InChI | InChI=1S/C22H27ClN4O2S/c1-3-26-10-12-27(13-11-26)19-9-8-17(14-18(19)23)24-22(30)25-21(28)15-29-20-7-5-4-6-16(20)2/h4-9,14H,3,10-13,15H2,1-2H3,(H2,24,25,28,30) |
| InChIKey | GIYTUICEVYJFDX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|