C21H26N4O4S2 — CID 17110172
2-(2-methylphenoxy)-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]acetamide (PubChem CID 17110172) has the molecular formula C21H26N4O4S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 2-(2-methylphenoxy)-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(2-methylphenoxy)-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 17110172 |
| Molecular Formula | C21H26N4O4S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-(2-methylphenoxy)-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]acetamide |
| SMILES | Cc1ccccc1OCC(=O)NC(=S)Nc1ccc(N2CCN(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O4S2/c1-16-5-3-4-6-19(16)29-15-20(26)23-21(30)22-17-7-9-18(10-8-17)24-11-13-25(14-12-24)31(2,27)28/h3-10H,11-15H2,1-2H3,(H2,22,23,26,30) |
| InChIKey | UYCUJFQXDRPISK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|