C25H35ClN4OS — CID 3893873
2-(1-adamantyl)-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]acetamide (PubChem CID 3893873) has the molecular formula C25H35ClN4OS and a molecular weight of 475.10 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3893873 |
| Molecular Formula | C25H35ClN4OS |
| Molecular Weight | 475.10 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 2-(1-adamantyl)-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=S)NC(=O)CC34CC5CC(CC(C5)C3)C4)cc2Cl)CC1 |
| InChI | InChI=1S/C25H35ClN4OS/c1-2-29-5-7-30(8-6-29)22-4-3-20(12-21(22)26)27-24(32)28-23(31)16-25-13-17-9-18(14-25)11-19(10-17)15-25/h3-4,12,17-19H,2,5-11,13-16H2,1H3,(H2,27,28,31,32) |
| InChIKey | TXWCTJWQCRTDJV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.10 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|