C24H30ClN3O3S — CID 43888109
N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]octanamide (PubChem CID 43888109) has the molecular formula C24H30ClN3O3S and a molecular weight of 476.04 g/mol. Its IUPAC name is N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]octanamide.
| Compound Name | N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]octanamide |
|---|---|
| PubChem CID | 43888109 |
| Molecular Formula | C24H30ClN3O3S |
| Molecular Weight | 476.04 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[[4-[2-(2-chlorophenoxy)propanoylamino]phenyl]carbamothioyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(=S)Nc1ccc(NC(=O)C(C)Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H30ClN3O3S/c1-3-4-5-6-7-12-22(29)28-24(32)27-19-15-13-18(14-16-19)26-23(30)17(2)31-21-11-9-8-10-20(21)25/h8-11,13-17H,3-7,12H2,1-2H3,(H,26,30)(H2,27,28,29,32) |
| InChIKey | GVTJCEGQOBTBTA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.04 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|