C27H27ClN2O5 — CID 43887770
2-phenylethyl 4-[4-[2-(2-chlorophenoxy)propanoylamino]anilino]-4-oxobutanoate (PubChem CID 43887770) has the molecular formula C27H27ClN2O5 and a molecular weight of 494.98 g/mol. Its IUPAC name is 2-phenylethyl 4-[4-[2-(2-chlorophenoxy)propanoylamino]anilino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[4-[2-(2-chlorophenoxy)propanoylamino]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 43887770 |
| Molecular Formula | C27H27ClN2O5 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2-phenylethyl 4-[4-[2-(2-chlorophenoxy)propanoylamino]anilino]-4-oxobutanoate |
| SMILES | CC(Oc1ccccc1Cl)C(=O)Nc1ccc(NC(=O)CCC(=O)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H27ClN2O5/c1-19(35-24-10-6-5-9-23(24)28)27(33)30-22-13-11-21(12-14-22)29-25(31)15-16-26(32)34-18-17-20-7-3-2-4-8-20/h2-14,19H,15-18H2,1H3,(H,29,31)(H,30,33) |
| InChIKey | YFEOSMYDNKWMJC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |