C19H27N3O6S2 — CID 17338835
2-methoxyethyl 4-oxo-4-[(4-piperidin-1-ylsulfonylphenyl)carbamothioylamino]butanoate (PubChem CID 17338835) has the molecular formula C19H27N3O6S2 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-methoxyethyl 4-oxo-4-[(4-piperidin-1-ylsulfonylphenyl)carbamothioylamino]butanoate.
| Compound Name | 2-methoxyethyl 4-oxo-4-[(4-piperidin-1-ylsulfonylphenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17338835 |
| Molecular Formula | C19H27N3O6S2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-methoxyethyl 4-oxo-4-[(4-piperidin-1-ylsulfonylphenyl)carbamothioylamino]butanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27N3O6S2/c1-27-13-14-28-18(24)10-9-17(23)21-19(29)20-15-5-7-16(8-6-15)30(25,26)22-11-3-2-4-12-22/h5-8H,2-4,9-14H2,1H3,(H2,20,21,23,29) |
| InChIKey | MLFAKOVXWHHSPJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|