C22H23Cl2N5O6S2 — CID 86809401
4-[bis(2-chloroethyl)sulfamoyl]-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide (PubChem CID 86809401) has the molecular formula C22H23Cl2N5O6S2 and a molecular weight of 588.50 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)sulfamoyl]-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-[bis(2-chloroethyl)sulfamoyl]-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 86809401 |
| Molecular Formula | C22H23Cl2N5O6S2 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.05 |
| IUPAC Name | 4-[bis(2-chloroethyl)sulfamoyl]-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=O)c2ccc(S(=O)(=O)N(CCCl)CCCl)cc2)cc1 |
| InChI | InChI=1S/C22H23Cl2N5O6S2/c1-35-22-20(25-12-13-26-22)28-36(31,32)18-8-4-17(5-9-18)27-21(30)16-2-6-19(7-3-16)37(33,34)29(14-10-23)15-11-24/h2-9,12-13H,10-11,14-15H2,1H3,(H,25,28)(H,27,30) |
| InChIKey | GKHZJQLRKJTTCJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|