C35H36Cl4N4O6S2 — CID 21203412
4-[bis(2-chloroethyl)sulfamoyl]-N-[4-[[4-[[4-[bis(2-chloroethyl)sulfamoyl]benzoyl]amino]phenyl]methyl]phenyl]benzamide (PubChem CID 21203412) has the molecular formula C35H36Cl4N4O6S2 and a molecular weight of 814.64 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)sulfamoyl]-N-[4-[[4-[[4-[bis(2-chloroethyl)sulfamoyl]benzoyl]amino]phenyl]methyl]phenyl]benzamide.
| Compound Name | 4-[bis(2-chloroethyl)sulfamoyl]-N-[4-[[4-[[4-[bis(2-chloroethyl)sulfamoyl]benzoyl]amino]phenyl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 21203412 |
| Molecular Formula | C35H36Cl4N4O6S2 |
| Molecular Weight | 814.64 g/mol |
| Exact Mass | 812.08 |
| IUPAC Name | 4-[bis(2-chloroethyl)sulfamoyl]-N-[4-[[4-[[4-[bis(2-chloroethyl)sulfamoyl]benzoyl]amino]phenyl]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)c3ccc(S(=O)(=O)N(CCCl)CCCl)cc3)cc2)cc1)c1ccc(S(=O)(=O)N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C35H36Cl4N4O6S2/c36-17-21-42(22-18-37)50(46,47)32-13-5-28(6-14-32)34(44)40-30-9-1-26(2-10-30)25-27-3-11-31(12-4-27)41-35(45)29-7-15-33(16-8-29)51(48,49)43(23-19-38)24-20-39/h1-16H,17-25H2,(H,40,44)(H,41,45) |
| InChIKey | ZNQNVDCXSBTBGB-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|