C19H22N2O4S2 — CID 43040903
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 3-acetamido-3-thiophen-2-ylpropanoate (PubChem CID 43040903) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 3-acetamido-3-thiophen-2-ylpropanoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 3-acetamido-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 43040903 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 3-acetamido-3-thiophen-2-ylpropanoate |
| SMILES | CC(=O)NC(CC(=O)OCC(=O)NCCSc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C19H22N2O4S2/c1-14(22)21-16(17-8-5-10-27-17)12-19(24)25-13-18(23)20-9-11-26-15-6-3-2-4-7-15/h2-8,10,16H,9,11-13H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | VRWIFMCWIMUSHU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|