C18H17F3N2O5S — CID 46508205
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 3-acetamido-3-thiophen-2-ylpropanoate (PubChem CID 46508205) has the molecular formula C18H17F3N2O5S and a molecular weight of 430.40 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 3-acetamido-3-thiophen-2-ylpropanoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 3-acetamido-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 46508205 |
| Molecular Formula | C18H17F3N2O5S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 3-acetamido-3-thiophen-2-ylpropanoate |
| SMILES | CC(=O)NC(CC(=O)OCC(=O)Nc1ccc(OC(F)(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C18H17F3N2O5S/c1-11(24)22-14(15-3-2-8-29-15)9-17(26)27-10-16(25)23-12-4-6-13(7-5-12)28-18(19,20)21/h2-8,14H,9-10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | GOXVTWLWKGHJPV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |