C22H26N2O5S — CID 46601070
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-acetamido-3-thiophen-2-ylpropanoate (PubChem CID 46601070) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-acetamido-3-thiophen-2-ylpropanoate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-acetamido-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 46601070 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-acetamido-3-thiophen-2-ylpropanoate |
| SMILES | CC(=O)NC(CC(=O)OCC(=O)c1ccc(NC(=O)CC(C)C)cc1)c1cccs1 |
| InChI | InChI=1S/C22H26N2O5S/c1-14(2)11-21(27)24-17-8-6-16(7-9-17)19(26)13-29-22(28)12-18(23-15(3)25)20-5-4-10-30-20/h4-10,14,18H,11-13H2,1-3H3,(H,23,25)(H,24,27) |
| InChIKey | SBILQADYFCKGQX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |