C14H11ClN4O4 — CID 108512860
N-(4-chloro-3-nitrophenyl)-N'-(4-methyl-2-pyridinyl)oxamide (PubChem CID 108512860) has the molecular formula C14H11ClN4O4 and a molecular weight of 334.72 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-N'-(4-methyl-2-pyridinyl)oxamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-N'-(4-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108512860 |
| Molecular Formula | C14H11ClN4O4 |
| Molecular Weight | 334.72 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-N'-(4-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1ccnc(NC(=O)C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C14H11ClN4O4/c1-8-4-5-16-12(6-8)18-14(21)13(20)17-9-2-3-10(15)11(7-9)19(22)23/h2-7H,1H3,(H,17,20)(H,16,18,21) |
| InChIKey | MGVSOLYAEJYIIN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|