C13H7Cl3N2O4 — CID 3391837
(2,3-dichlorophenyl) N-(4-chloro-3-nitrophenyl)carbamate (PubChem CID 3391837) has the molecular formula C13H7Cl3N2O4 and a molecular weight of 361.57 g/mol. Its IUPAC name is (2,3-dichlorophenyl) N-(4-chloro-3-nitrophenyl)carbamate.
| Compound Name | (2,3-dichlorophenyl) N-(4-chloro-3-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 3391837 |
| Molecular Formula | C13H7Cl3N2O4 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | (2,3-dichlorophenyl) N-(4-chloro-3-nitrophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H7Cl3N2O4/c14-8-5-4-7(6-10(8)18(20)21)17-13(19)22-11-3-1-2-9(15)12(11)16/h1-6H,(H,17,19) |
| InChIKey | FHIKQELVZXCVSL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|