C22H21ClN4O3 — CID 51061184
N-[2-[(2E)-2-[(2-chloroquinolin-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-4-propoxybenzamide (PubChem CID 51061184) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is N-[2-[(2E)-2-[(2-chloroquinolin-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-4-propoxybenzamide.
| Compound Name | N-[2-[(2E)-2-[(2-chloroquinolin-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 51061184 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[2-[(2E)-2-[(2-chloroquinolin-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NCC(=O)N/N=C/c2cc3ccccc3nc2Cl)cc1 |
| InChI | InChI=1S/C22H21ClN4O3/c1-2-11-30-18-9-7-15(8-10-18)22(29)24-14-20(28)27-25-13-17-12-16-5-3-4-6-19(16)26-21(17)23/h3-10,12-13H,2,11,14H2,1H3,(H,24,29)(H,27,28)/b25-13+ |
| InChIKey | DRDPUQTWBCROBP-DHRITJCHSA-N |
| XLogP | 3.56 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|