C14H8ClF9 — CID 163683256
2-[(2Z)-2,4-bis(trifluoromethyl)penta-2,4-dienyl]-1-chloro-4-(trifluoromethyl)benzene (PubChem CID 163683256) has the molecular formula C14H8ClF9 and a molecular weight of 382.65 g/mol. Its IUPAC name is 2-[(2Z)-2,4-bis(trifluoromethyl)penta-2,4-dienyl]-1-chloro-4-(trifluoromethyl)benzene.
| Compound Name | 2-[(2Z)-2,4-bis(trifluoromethyl)penta-2,4-dienyl]-1-chloro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 163683256 |
| Molecular Formula | C14H8ClF9 |
| Molecular Weight | 382.65 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-[(2Z)-2,4-bis(trifluoromethyl)penta-2,4-dienyl]-1-chloro-4-(trifluoromethyl)benzene |
| SMILES | C=C(/C=C(/Cc1cc(C(F)(F)F)ccc1Cl)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H8ClF9/c1-7(12(16,17)18)4-10(14(22,23)24)6-8-5-9(13(19,20)21)2-3-11(8)15/h2-5H,1,6H2/b10-4- |
| InChIKey | JMPWGQOOSYHFCX-WMZJFQQLSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|