C27H29N3O5 — CID 108764421
[2-methoxy-4-[(E)-3-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 108764421) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-3-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 108764421 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | [2-methoxy-4-[(E)-3-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(c3cc(C)c4cccc(OC)c4n3)CC2)ccc1OC(C)=O |
| InChI | InChI=1S/C27H29N3O5/c1-18-16-25(28-27-21(18)6-5-7-23(27)33-3)29-12-14-30(15-13-29)26(32)11-9-20-8-10-22(35-19(2)31)24(17-20)34-4/h5-11,16-17H,12-15H2,1-4H3/b11-9+ |
| InChIKey | DFXIFLCSVSXDGY-PKNBQFBNSA-N |
| XLogP | 3.85 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|