C26H27N3O4 — CID 108764413
(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 108764413) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 108764413 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cccc2c(C)cc(N3CCN(C(=O)/C=C\c4ccc5c(c4)OCCO5)CC3)nc12 |
| InChI | InChI=1S/C26H27N3O4/c1-18-16-24(27-26-20(18)4-3-5-22(26)31-2)28-10-12-29(13-11-28)25(30)9-7-19-6-8-21-23(17-19)33-15-14-32-21/h3-9,16-17H,10-15H2,1-2H3/b9-7- |
| InChIKey | QCFYKZSVHTXBIM-CLFYSBASSA-N |
| XLogP | 3.69 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|