C27H29N3O4 — CID 108754779
[4-[(E)-3-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 108754779) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is [4-[(E)-3-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(E)-3-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 108754779 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [4-[(E)-3-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(c3cc(C)c4cccc(C)c4n3)CC2)ccc1OC(C)=O |
| InChI | InChI=1S/C27H29N3O4/c1-18-6-5-7-22-19(2)16-25(28-27(18)22)29-12-14-30(15-13-29)26(32)11-9-21-8-10-23(34-20(3)31)24(17-21)33-4/h5-11,16-17H,12-15H2,1-4H3/b11-9+ |
| InChIKey | VUCQCPARZYROCS-PKNBQFBNSA-N |
| XLogP | 4.15 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|