C28H34N4O2 — CID 108731178
N-[6-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-6-oxohexyl]benzamide (PubChem CID 108731178) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[6-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-6-oxohexyl]benzamide.
| Compound Name | N-[6-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 108731178 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N-[6-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-6-oxohexyl]benzamide |
| SMILES | Cc1cc(N2CCN(C(=O)CCCCCNC(=O)c3ccccc3)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C28H34N4O2/c1-21-10-9-13-24-22(2)20-25(30-27(21)24)31-16-18-32(19-17-31)26(33)14-7-4-8-15-29-28(34)23-11-5-3-6-12-23/h3,5-6,9-13,20H,4,7-8,14-19H2,1-2H3,(H,29,34) |
| InChIKey | WHZCOPUXJLDPFU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|