C25H29N3O2 — CID 108764157
4-(2,6-dimethylphenoxy)-1-(4-quinolin-2-ylpiperazin-1-yl)butan-1-one (PubChem CID 108764157) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)-1-(4-quinolin-2-ylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-(2,6-dimethylphenoxy)-1-(4-quinolin-2-ylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 108764157 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)-1-(4-quinolin-2-ylpiperazin-1-yl)butan-1-one |
| SMILES | Cc1cccc(C)c1OCCCC(=O)N1CCN(c2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C25H29N3O2/c1-19-7-5-8-20(2)25(19)30-18-6-11-24(29)28-16-14-27(15-17-28)23-13-12-21-9-3-4-10-22(21)26-23/h3-5,7-10,12-13H,6,11,14-18H2,1-2H3 |
| InChIKey | YTZYPEFHAGCUJK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|