C18H22ClN3O5S — CID 27993480
N'-(3-chloro-4-methyl-5-nitrophenyl)sulfonyladamantane-1-carbohydrazide (PubChem CID 27993480) has the molecular formula C18H22ClN3O5S and a molecular weight of 427.91 g/mol. Its IUPAC name is N'-(3-chloro-4-methyl-5-nitrophenyl)sulfonyladamantane-1-carbohydrazide.
| Compound Name | N'-(3-chloro-4-methyl-5-nitrophenyl)sulfonyladamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 27993480 |
| Molecular Formula | C18H22ClN3O5S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N'-(3-chloro-4-methyl-5-nitrophenyl)sulfonyladamantane-1-carbohydrazide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)NNC(=O)C23CC4CC(CC(C4)C2)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22ClN3O5S/c1-10-15(19)5-14(6-16(10)22(24)25)28(26,27)21-20-17(23)18-7-11-2-12(8-18)4-13(3-11)9-18/h5-6,11-13,21H,2-4,7-9H2,1H3,(H,20,23) |
| InChIKey | SJIRVRDCNKEGOM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|