C23H21F2NO5S — CID 11959212
methyl 5-[2-[4-(3,4-difluorophenoxy)phenyl]ethylsulfamoyl]-2-methylbenzoate (PubChem CID 11959212) has the molecular formula C23H21F2NO5S and a molecular weight of 461.49 g/mol. Its IUPAC name is methyl 5-[2-[4-(3,4-difluorophenoxy)phenyl]ethylsulfamoyl]-2-methylbenzoate.
| Compound Name | methyl 5-[2-[4-(3,4-difluorophenoxy)phenyl]ethylsulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 11959212 |
| Molecular Formula | C23H21F2NO5S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | methyl 5-[2-[4-(3,4-difluorophenoxy)phenyl]ethylsulfamoyl]-2-methylbenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCc2ccc(Oc3ccc(F)c(F)c3)cc2)ccc1C |
| InChI | InChI=1S/C23H21F2NO5S/c1-15-3-9-19(14-20(15)23(27)30-2)32(28,29)26-12-11-16-4-6-17(7-5-16)31-18-8-10-21(24)22(25)13-18/h3-10,13-14,26H,11-12H2,1-2H3 |
| InChIKey | NAIHTYFEBSWKLC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |