C23H22FNO5S — CID 11655168
5-[2-[4-(4-fluoro-3-methylphenoxy)phenyl]ethylsulfamoyl]-2-methylbenzoic acid (PubChem CID 11655168) has the molecular formula C23H22FNO5S and a molecular weight of 443.50 g/mol. Its IUPAC name is 5-[2-[4-(4-fluoro-3-methylphenoxy)phenyl]ethylsulfamoyl]-2-methylbenzoic acid.
| Compound Name | 5-[2-[4-(4-fluoro-3-methylphenoxy)phenyl]ethylsulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 11655168 |
| Molecular Formula | C23H22FNO5S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 5-[2-[4-(4-fluoro-3-methylphenoxy)phenyl]ethylsulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(Oc2ccc(CCNS(=O)(=O)c3ccc(C)c(C(=O)O)c3)cc2)ccc1F |
| InChI | InChI=1S/C23H22FNO5S/c1-15-3-9-20(14-21(15)23(26)27)31(28,29)25-12-11-17-4-6-18(7-5-17)30-19-8-10-22(24)16(2)13-19/h3-10,13-14,25H,11-12H2,1-2H3,(H,26,27) |
| InChIKey | FRUOJONZQGLWQR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |