C17H26N4O4S — CID 119465925
N-[3-(2-aminoethylsulfamoyl)phenyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 119465925) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 119465925 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | CC(C)C(C(=O)Nc1cccc(S(=O)(=O)NCCN)c1)N1CCCC1=O |
| InChI | InChI=1S/C17H26N4O4S/c1-12(2)16(21-10-4-7-15(21)22)17(23)20-13-5-3-6-14(11-13)26(24,25)19-9-8-18/h3,5-6,11-12,16,19H,4,7-10,18H2,1-2H3,(H,20,23) |
| InChIKey | XJDPQLJROMWFBV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |