C18H22N2O3 — CID 95616837
(2R)-3-methyl-2-(2-oxopyrrolidin-1-yl)-N-(3-prop-2-ynoxyphenyl)butanamide (PubChem CID 95616837) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2R)-3-methyl-2-(2-oxopyrrolidin-1-yl)-N-(3-prop-2-ynoxyphenyl)butanamide.
| Compound Name | (2R)-3-methyl-2-(2-oxopyrrolidin-1-yl)-N-(3-prop-2-ynoxyphenyl)butanamide |
|---|---|
| PubChem CID | 95616837 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2R)-3-methyl-2-(2-oxopyrrolidin-1-yl)-N-(3-prop-2-ynoxyphenyl)butanamide |
| SMILES | C#CCOc1cccc(NC(=O)[C@@H](C(C)C)N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-4-11-23-15-8-5-7-14(12-15)19-18(22)17(13(2)3)20-10-6-9-16(20)21/h1,5,7-8,12-13,17H,6,9-11H2,2-3H3,(H,19,22)/t17-/m1/s1 |
| InChIKey | FXJFLXUMSGQDRT-QGZVFWFLSA-N |
| XLogP | 2.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|