C23H24ClN3O2 — CID 60620056
N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 60620056) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 60620056 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[3-chloro-4-[cyano(phenyl)methyl]phenyl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | CC(C)C(C(=O)Nc1ccc(C(C#N)c2ccccc2)c(Cl)c1)N1CCCC1=O |
| InChI | InChI=1S/C23H24ClN3O2/c1-15(2)22(27-12-6-9-21(27)28)23(29)26-17-10-11-18(20(24)13-17)19(14-25)16-7-4-3-5-8-16/h3-5,7-8,10-11,13,15,19,22H,6,9,12H2,1-2H3,(H,26,29) |
| InChIKey | SJEAVWNXRJNKCU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |