C25H18ClN3O — CID 40729498
1-[3-chloro-4-[(R)-cyano(phenyl)methyl]phenyl]-3-naphthalen-1-ylurea (PubChem CID 40729498) has the molecular formula C25H18ClN3O and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-[3-chloro-4-[(R)-cyano(phenyl)methyl]phenyl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[3-chloro-4-[(R)-cyano(phenyl)methyl]phenyl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 40729498 |
| Molecular Formula | C25H18ClN3O |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-[3-chloro-4-[(R)-cyano(phenyl)methyl]phenyl]-3-naphthalen-1-ylurea |
| SMILES | N#C[C@H](c1ccccc1)c1ccc(NC(=O)Nc2cccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C25H18ClN3O/c26-23-15-19(13-14-21(23)22(16-27)18-7-2-1-3-8-18)28-25(30)29-24-12-6-10-17-9-4-5-11-20(17)24/h1-15,22H,(H2,28,29,30)/t22-/m1/s1 |
| InChIKey | WZHODFZFDOHUGF-JOCHJYFZSA-N |
| XLogP | 6.79 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |